C32H45BrN2O2S — CID 19924237
4-tert-butyl-3-decoxy-N-[3-[(5-methyl-1,3-thiazol-3-ium-3-yl)methyl]phenyl]benzamide bromide (PubChem CID 19924237) has the molecular formula C32H45BrN2O2S and a molecular weight of 601.70 g/mol. Its IUPAC name is 4-tert-butyl-3-decoxy-N-[3-[(5-methyl-1,3-thiazol-3-ium-3-yl)methyl]phenyl]benzamide bromide.
| Compound Name | 4-tert-butyl-3-decoxy-N-[3-[(5-methyl-1,3-thiazol-3-ium-3-yl)methyl]phenyl]benzamide bromide |
|---|---|
| PubChem CID | 19924237 |
| Molecular Formula | C32H45BrN2O2S |
| Molecular Weight | 601.70 g/mol |
| Exact Mass | 600.24 |
| IUPAC Name | 4-tert-butyl-3-decoxy-N-[3-[(5-methyl-1,3-thiazol-3-ium-3-yl)methyl]phenyl]benzamide bromide |
| SMILES | CCCCCCCCCCOc1cc(C(=O)Nc2cccc(C[n+]3csc(C)c3)c2)ccc1C(C)(C)C.[Br-] |
| InChI | InChI=1S/C32H44N2O2S.BrH/c1-6-7-8-9-10-11-12-13-19-36-30-21-27(17-18-29(30)32(3,4)5)31(35)33-28-16-14-15-26(20-28)23-34-22-25(2)37-24-34;/h14-18,20-22,24H,6-13,19,23H2,1-5H3;1H |
| InChIKey | HKBBZAJDYUVEEA-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.70 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|