About 3-benzyl-3H-1,2-benzodioxole
3-benzyl-3H-1,2-benzodioxole (PubChem CID 19926660) has the molecular formula C14H12O2
and a molecular weight of 212.25 g/mol. Its IUPAC name is 3-benzyl-3H-1,2-benzodioxole.
Molecular Properties
| Compound Name | 3-benzyl-3H-1,2-benzodioxole |
| PubChem CID | 19926660 |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 3-benzyl-3H-1,2-benzodioxole |
| SMILES | c1ccc(CC2OOc3ccccc32)cc1 |
| InChI | InChI=1S/C14H12O2/c1-2-6-11(7-3-1)10-14-12-8-4-5-9-13(12)15-16-14/h1-9,14H,10H2 |
| InChIKey | FJSLIXIFSQQYAJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyl-3H-1,2-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-3H-1,2-benzodioxole?
The IUPAC name of 3-benzyl-3H-1,2-benzodioxole (CID 19926660) is 3-benzyl-3H-1,2-benzodioxole.
What is the SMILES notation for 3-benzyl-3H-1,2-benzodioxole?
The canonical SMILES for 3-benzyl-3H-1,2-benzodioxole is c1ccc(CC2OOc3ccccc32)cc1.
What is the InChIKey of 3-benzyl-3H-1,2-benzodioxole?
The InChIKey is FJSLIXIFSQQYAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O2/c1-2-6-11(7-3-1)10-14-12-8-4-5-9-13(12)15-16-14/h1-9,14H,10H2.
What are the key properties of 3-benzyl-3H-1,2-benzodioxole?
3-benzyl-3H-1,2-benzodioxole has a molecular weight of 212.25 g/mol, XLogP of 3.29, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-3H-1,2-benzodioxole is sourced from PubChem (CID 19926660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).