C20H15N3O8S2 — CID 19926837
1-amino-4-(4-aminoanilino)-9,10-dioxoanthracene-2,7-disulfonic acid (PubChem CID 19926837) has the molecular formula C20H15N3O8S2 and a molecular weight of 489.49 g/mol. Its IUPAC name is 1-amino-4-(4-aminoanilino)-9,10-dioxoanthracene-2,7-disulfonic acid.
| Compound Name | 1-amino-4-(4-aminoanilino)-9,10-dioxoanthracene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 19926837 |
| Molecular Formula | C20H15N3O8S2 |
| Molecular Weight | 489.49 g/mol |
| Exact Mass | 489.03 |
| IUPAC Name | 1-amino-4-(4-aminoanilino)-9,10-dioxoanthracene-2,7-disulfonic acid |
| SMILES | Nc1ccc(Nc2cc(S(=O)(=O)O)c(N)c3c2C(=O)c2ccc(S(=O)(=O)O)cc2C3=O)cc1 |
| InChI | InChI=1S/C20H15N3O8S2/c21-9-1-3-10(4-2-9)23-14-8-15(33(29,30)31)18(22)17-16(14)19(24)12-6-5-11(32(26,27)28)7-13(12)20(17)25/h1-8,23H,21-22H2,(H,26,27,28)(H,29,30,31) |
| InChIKey | PXSBIEOCZPFFDT-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 206.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.49 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|