About diethyl (E)-2-[2,3,4-trifluoro-N-(2-fluoroethyl)anilino]but-2-enedioate
diethyl (E)-2-[2,3,4-trifluoro-N-(2-fluoroethyl)anilino]but-2-enedioate (PubChem CID 19926861) has the molecular formula C16H17F4NO4
and a molecular weight of 363.30 g/mol. Its IUPAC name is diethyl (E)-2-[2,3,4-trifluoro-N-(2-fluoroethyl)anilino]but-2-enedioate.
Molecular Properties
| Compound Name | diethyl (E)-2-[2,3,4-trifluoro-N-(2-fluoroethyl)anilino]but-2-enedioate |
| PubChem CID | 19926861 |
| Molecular Formula | C16H17F4NO4 |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | diethyl (E)-2-[2,3,4-trifluoro-N-(2-fluoroethyl)anilino]but-2-enedioate |
| SMILES | CCOC(=O)/C=C(\C(=O)OCC)/N(CCF)C1=C(C(=C(C=C1)F)F)F |
| InChI | InChI=1S/C16H17F4NO4/c1-3-24-13(22)9-12(16(23)25-4-2)21(8-7-17)11-6-5-10(18)14(19)15(11)20/h5-6,9H,3-4,7-8H2,1-2H3/b12-9+ |
| InChIKey | YCIZHZQCOISKHO-FMIVXFBMSA-N |
| XLogP | 3.50 |
| TPSA | 55.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | 489 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze diethyl (E)-2-[2,3,4-trifluoro-N-(2-fluoroethyl)anilino]but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl (E)-2-[2,3,4-trifluoro-N-(2-fluoroethyl)anilino]but-2-enedioate?
The IUPAC name of diethyl (E)-2-[2,3,4-trifluoro-N-(2-fluoroethyl)anilino]but-2-enedioate (CID 19926861) is diethyl (E)-2-[2,3,4-trifluoro-N-(2-fluoroethyl)anilino]but-2-enedioate.
What is the SMILES notation for diethyl (E)-2-[2,3,4-trifluoro-N-(2-fluoroethyl)anilino]but-2-enedioate?
The canonical SMILES for diethyl (E)-2-[2,3,4-trifluoro-N-(2-fluoroethyl)anilino]but-2-enedioate is CCOC(=O)/C=C(\C(=O)OCC)/N(CCF)C1=C(C(=C(C=C1)F)F)F.
What is the InChIKey of diethyl (E)-2-[2,3,4-trifluoro-N-(2-fluoroethyl)anilino]but-2-enedioate?
The InChIKey is YCIZHZQCOISKHO-FMIVXFBMSA-N. The full InChI is InChI=1S/C16H17F4NO4/c1-3-24-13(22)9-12(16(23)25-4-2)21(8-7-17)11-6-5-10(18)14(19)15(11)20/h5-6,9H,3-4,7-8H2,1-2H3/b12-9+.
What are the key properties of diethyl (E)-2-[2,3,4-trifluoro-N-(2-fluoroethyl)anilino]but-2-enedioate?
diethyl (E)-2-[2,3,4-trifluoro-N-(2-fluoroethyl)anilino]but-2-enedioate has a molecular weight of 363.30 g/mol, XLogP of 3.50, 10 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl (E)-2-[2,3,4-trifluoro-N-(2-fluoroethyl)anilino]but-2-enedioate is sourced from PubChem (CID 19926861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).