About 7-chloro-4a-methyl-4,9-dihydro-3H-phenanthrene-2-carboxylic acid
7-chloro-4a-methyl-4,9-dihydro-3H-phenanthrene-2-carboxylic acid (PubChem CID 19927034) has the molecular formula C16H15ClO2
and a molecular weight of 274.75 g/mol. Its IUPAC name is 7-chloro-4a-methyl-4,9-dihydro-3H-phenanthrene-2-carboxylic acid.
Molecular Properties
| Compound Name | 7-chloro-4a-methyl-4,9-dihydro-3H-phenanthrene-2-carboxylic acid |
| PubChem CID | 19927034 |
| Molecular Formula | C16H15ClO2 |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 7-chloro-4a-methyl-4,9-dihydro-3H-phenanthrene-2-carboxylic acid |
| SMILES | CC12CCC(C(=O)O)=CC1=CCc1cc(Cl)ccc12 |
| InChI | InChI=1S/C16H15ClO2/c1-16-7-6-11(15(18)19)8-12(16)3-2-10-9-13(17)4-5-14(10)16/h3-5,8-9H,2,6-7H2,1H3,(H,18,19) |
| InChIKey | BWIBKWVUAHMKER-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-chloro-4a-methyl-4,9-dihydro-3H-phenanthrene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-4a-methyl-4,9-dihydro-3H-phenanthrene-2-carboxylic acid?
The IUPAC name of 7-chloro-4a-methyl-4,9-dihydro-3H-phenanthrene-2-carboxylic acid (CID 19927034) is 7-chloro-4a-methyl-4,9-dihydro-3H-phenanthrene-2-carboxylic acid.
What is the SMILES notation for 7-chloro-4a-methyl-4,9-dihydro-3H-phenanthrene-2-carboxylic acid?
The canonical SMILES for 7-chloro-4a-methyl-4,9-dihydro-3H-phenanthrene-2-carboxylic acid is CC12CCC(C(=O)O)=CC1=CCc1cc(Cl)ccc12.
What is the InChIKey of 7-chloro-4a-methyl-4,9-dihydro-3H-phenanthrene-2-carboxylic acid?
The InChIKey is BWIBKWVUAHMKER-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15ClO2/c1-16-7-6-11(15(18)19)8-12(16)3-2-10-9-13(17)4-5-14(10)16/h3-5,8-9H,2,6-7H2,1H3,(H,18,19).
What are the key properties of 7-chloro-4a-methyl-4,9-dihydro-3H-phenanthrene-2-carboxylic acid?
7-chloro-4a-methyl-4,9-dihydro-3H-phenanthrene-2-carboxylic acid has a molecular weight of 274.75 g/mol, XLogP of 3.88, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-4a-methyl-4,9-dihydro-3H-phenanthrene-2-carboxylic acid is sourced from PubChem (CID 19927034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).