About ethenyl 2-propylheptanoate
ethenyl 2-propylheptanoate (PubChem CID 19927099) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is ethenyl 2-propylheptanoate.
Molecular Properties
| Compound Name | ethenyl 2-propylheptanoate |
| PubChem CID | 19927099 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | ethenyl 2-propylheptanoate |
| SMILES | C=COC(=O)C(CCC)CCCCC |
| InChI | InChI=1S/C12H22O2/c1-4-7-8-10-11(9-5-2)12(13)14-6-3/h6,11H,3-5,7-10H2,1-2H3 |
| InChIKey | KHIIJNDFZWFGLZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethenyl 2-propylheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl 2-propylheptanoate?
The IUPAC name of ethenyl 2-propylheptanoate (CID 19927099) is ethenyl 2-propylheptanoate.
What is the SMILES notation for ethenyl 2-propylheptanoate?
The canonical SMILES for ethenyl 2-propylheptanoate is C=COC(=O)C(CCC)CCCCC.
What is the InChIKey of ethenyl 2-propylheptanoate?
The InChIKey is KHIIJNDFZWFGLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2/c1-4-7-8-10-11(9-5-2)12(13)14-6-3/h6,11H,3-5,7-10H2,1-2H3.
What are the key properties of ethenyl 2-propylheptanoate?
ethenyl 2-propylheptanoate has a molecular weight of 198.31 g/mol, XLogP of 3.67, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl 2-propylheptanoate is sourced from PubChem (CID 19927099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).