C48H58N2O2 — CID 19927148
4-[4-[1-[4-(4-amino-2-methylphenoxy)-3-methylphenyl]-4-(3-octylphenyl)cyclohexyl]-2-methylphenoxy]-3-methylaniline (PubChem CID 19927148) has the molecular formula C48H58N2O2 and a molecular weight of 695.00 g/mol. Its IUPAC name is 4-[4-[1-[4-(4-amino-2-methylphenoxy)-3-methylphenyl]-4-(3-octylphenyl)cyclohexyl]-2-methylphenoxy]-3-methylaniline.
| Compound Name | 4-[4-[1-[4-(4-amino-2-methylphenoxy)-3-methylphenyl]-4-(3-octylphenyl)cyclohexyl]-2-methylphenoxy]-3-methylaniline |
|---|---|
| PubChem CID | 19927148 |
| Molecular Formula | C48H58N2O2 |
| Molecular Weight | 695.00 g/mol |
| Exact Mass | 694.45 |
| IUPAC Name | 4-[4-[1-[4-(4-amino-2-methylphenoxy)-3-methylphenyl]-4-(3-octylphenyl)cyclohexyl]-2-methylphenoxy]-3-methylaniline |
| SMILES | CCCCCCCCc1cccc(C2CCC(c3ccc(Oc4ccc(N)cc4C)c(C)c3)(c3ccc(Oc4ccc(N)cc4C)c(C)c3)CC2)c1 |
| InChI | InChI=1S/C48H58N2O2/c1-6-7-8-9-10-11-13-37-14-12-15-39(32-37)38-24-26-48(27-25-38,40-16-20-44(33(2)28-40)51-46-22-18-42(49)30-35(46)4)41-17-21-45(34(3)29-41)52-47-23-19-43(50)31-36(47)5/h12,14-23,28-32,38H,6-11,13,24-27,49-50H2,1-5H3 |
| InChIKey | XSEYFNIWJPWICE-UHFFFAOYSA-N |
| XLogP | 13.22 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.00 |
| LogP ≤ 5 | 13.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|