About [2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl] 2-(phenylmethoxycarbonylamino)acetate
[2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl] 2-(phenylmethoxycarbonylamino)acetate (PubChem CID 19927867) has the molecular formula C27H26N4O4
and a molecular weight of 470.53 g/mol. Its IUPAC name is [2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl] 2-(phenylmethoxycarbonylamino)acetate.
Molecular Properties
| Compound Name | [2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl] 2-(phenylmethoxycarbonylamino)acetate |
| PubChem CID | 19927867 |
| Molecular Formula | C27H26N4O4 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | [2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl] 2-(phenylmethoxycarbonylamino)acetate |
| SMILES | Cc1cc(Nc2ccn(-c3ccccc3)n2)cc(C)c1OC(=O)CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H26N4O4/c1-19-15-22(29-24-13-14-31(30-24)23-11-7-4-8-12-23)16-20(2)26(19)35-25(32)17-28-27(33)34-18-21-9-5-3-6-10-21/h3-16H,17-18H2,1-2H3,(H,28,33)(H,29,30) |
| InChIKey | ZKNUSKAMUOKQQC-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl] 2-(phenylmethoxycarbonylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl] 2-(phenylmethoxycarbonylamino)acetate?
The IUPAC name of [2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl] 2-(phenylmethoxycarbonylamino)acetate (CID 19927867) is [2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl] 2-(phenylmethoxycarbonylamino)acetate.
What is the SMILES notation for [2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl] 2-(phenylmethoxycarbonylamino)acetate?
The canonical SMILES for [2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl] 2-(phenylmethoxycarbonylamino)acetate is Cc1cc(Nc2ccn(-c3ccccc3)n2)cc(C)c1OC(=O)CNC(=O)OCc1ccccc1.
What is the InChIKey of [2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl] 2-(phenylmethoxycarbonylamino)acetate?
The InChIKey is ZKNUSKAMUOKQQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H26N4O4/c1-19-15-22(29-24-13-14-31(30-24)23-11-7-4-8-12-23)16-20(2)26(19)35-25(32)17-28-27(33)34-18-21-9-5-3-6-10-21/h3-16H,17-18H2,1-2H3,(H,28,33)(H,29,30).
What are the key properties of [2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl] 2-(phenylmethoxycarbonylamino)acetate?
[2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl] 2-(phenylmethoxycarbonylamino)acetate has a molecular weight of 470.53 g/mol, XLogP of 5.06, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl] 2-(phenylmethoxycarbonylamino)acetate is sourced from PubChem (CID 19927867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).