C16H35NO2 — CID 19928714
3,7,11-trimethyl-2-(methylamino)dodecane-1,3-diol (PubChem CID 19928714) has the molecular formula C16H35NO2 and a molecular weight of 273.46 g/mol. Its IUPAC name is 3,7,11-trimethyl-2-(methylamino)dodecane-1,3-diol.
| Compound Name | 3,7,11-trimethyl-2-(methylamino)dodecane-1,3-diol |
|---|---|
| PubChem CID | 19928714 |
| Molecular Formula | C16H35NO2 |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.27 |
| IUPAC Name | 3,7,11-trimethyl-2-(methylamino)dodecane-1,3-diol |
| SMILES | CNC(CO)C(C)(O)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C16H35NO2/c1-13(2)8-6-9-14(3)10-7-11-16(4,19)15(12-18)17-5/h13-15,17-19H,6-12H2,1-5H3 |
| InChIKey | LCIWWMFNDBZAFP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |