C18H34N2O2 — CID 19928720
2-imidazol-1-yl-3,7,11-trimethyldodecane-1,3-diol (PubChem CID 19928720) has the molecular formula C18H34N2O2 and a molecular weight of 310.48 g/mol. Its IUPAC name is 2-imidazol-1-yl-3,7,11-trimethyldodecane-1,3-diol.
| Compound Name | 2-imidazol-1-yl-3,7,11-trimethyldodecane-1,3-diol |
|---|---|
| PubChem CID | 19928720 |
| Molecular Formula | C18H34N2O2 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.26 |
| IUPAC Name | 2-imidazol-1-yl-3,7,11-trimethyldodecane-1,3-diol |
| SMILES | CC(C)CCCC(C)CCCC(C)(O)C(CO)n1ccnc1 |
| InChI | InChI=1S/C18H34N2O2/c1-15(2)7-5-8-16(3)9-6-10-18(4,22)17(13-21)20-12-11-19-14-20/h11-12,14-17,21-22H,5-10,13H2,1-4H3 |
| InChIKey | LSGJPDGKKKKSKY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |