About 2-(dibutylamino)-3,7-dimethyloct-6-ene-1,3-diol
2-(dibutylamino)-3,7-dimethyloct-6-ene-1,3-diol (PubChem CID 19928740) has the molecular formula C18H37NO2
and a molecular weight of 299.50 g/mol. Its IUPAC name is 2-(dibutylamino)-3,7-dimethyloct-6-ene-1,3-diol.
Molecular Properties
| Compound Name | 2-(dibutylamino)-3,7-dimethyloct-6-ene-1,3-diol |
| PubChem CID | 19928740 |
| Molecular Formula | C18H37NO2 |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.28 |
| IUPAC Name | 2-(dibutylamino)-3,7-dimethyloct-6-ene-1,3-diol |
| SMILES | CCCCN(CCCC)C(CO)C(C)(O)CCC=C(C)C |
| InChI | InChI=1S/C18H37NO2/c1-6-8-13-19(14-9-7-2)17(15-20)18(5,21)12-10-11-16(3)4/h11,17,20-21H,6-10,12-15H2,1-5H3 |
| InChIKey | HODRFXSYUOIPRT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(dibutylamino)-3,7-dimethyloct-6-ene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dibutylamino)-3,7-dimethyloct-6-ene-1,3-diol?
The IUPAC name of 2-(dibutylamino)-3,7-dimethyloct-6-ene-1,3-diol (CID 19928740) is 2-(dibutylamino)-3,7-dimethyloct-6-ene-1,3-diol.
What is the SMILES notation for 2-(dibutylamino)-3,7-dimethyloct-6-ene-1,3-diol?
The canonical SMILES for 2-(dibutylamino)-3,7-dimethyloct-6-ene-1,3-diol is CCCCN(CCCC)C(CO)C(C)(O)CCC=C(C)C.
What is the InChIKey of 2-(dibutylamino)-3,7-dimethyloct-6-ene-1,3-diol?
The InChIKey is HODRFXSYUOIPRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37NO2/c1-6-8-13-19(14-9-7-2)17(15-20)18(5,21)12-10-11-16(3)4/h11,17,20-21H,6-10,12-15H2,1-5H3.
What are the key properties of 2-(dibutylamino)-3,7-dimethyloct-6-ene-1,3-diol?
2-(dibutylamino)-3,7-dimethyloct-6-ene-1,3-diol has a molecular weight of 299.50 g/mol, XLogP of 3.75, 12 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dibutylamino)-3,7-dimethyloct-6-ene-1,3-diol is sourced from PubChem (CID 19928740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).