About 2-(3-hydroxypropylamino)-3,7-dimethyloct-6-ene-1,3-diol
2-(3-hydroxypropylamino)-3,7-dimethyloct-6-ene-1,3-diol (PubChem CID 19928742) has the molecular formula C13H27NO3
and a molecular weight of 245.36 g/mol. Its IUPAC name is 2-(3-hydroxypropylamino)-3,7-dimethyloct-6-ene-1,3-diol.
Molecular Properties
| Compound Name | 2-(3-hydroxypropylamino)-3,7-dimethyloct-6-ene-1,3-diol |
| PubChem CID | 19928742 |
| Molecular Formula | C13H27NO3 |
| Molecular Weight | 245.36 g/mol |
| Exact Mass | 245.20 |
| IUPAC Name | 2-(3-hydroxypropylamino)-3,7-dimethyloct-6-ene-1,3-diol |
| SMILES | CC(C)=CCCC(C)(O)C(CO)NCCCO |
| InChI | InChI=1S/C13H27NO3/c1-11(2)6-4-7-13(3,17)12(10-16)14-8-5-9-15/h6,12,14-17H,4-5,7-10H2,1-3H3 |
| InChIKey | GTUGJPJPTCDYTQ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.36 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-hydroxypropylamino)-3,7-dimethyloct-6-ene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-hydroxypropylamino)-3,7-dimethyloct-6-ene-1,3-diol?
The IUPAC name of 2-(3-hydroxypropylamino)-3,7-dimethyloct-6-ene-1,3-diol (CID 19928742) is 2-(3-hydroxypropylamino)-3,7-dimethyloct-6-ene-1,3-diol.
What is the SMILES notation for 2-(3-hydroxypropylamino)-3,7-dimethyloct-6-ene-1,3-diol?
The canonical SMILES for 2-(3-hydroxypropylamino)-3,7-dimethyloct-6-ene-1,3-diol is CC(C)=CCCC(C)(O)C(CO)NCCCO.
What is the InChIKey of 2-(3-hydroxypropylamino)-3,7-dimethyloct-6-ene-1,3-diol?
The InChIKey is GTUGJPJPTCDYTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO3/c1-11(2)6-4-7-13(3,17)12(10-16)14-8-5-9-15/h6,12,14-17H,4-5,7-10H2,1-3H3.
What are the key properties of 2-(3-hydroxypropylamino)-3,7-dimethyloct-6-ene-1,3-diol?
2-(3-hydroxypropylamino)-3,7-dimethyloct-6-ene-1,3-diol has a molecular weight of 245.36 g/mol, XLogP of 0.82, 9 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-hydroxypropylamino)-3,7-dimethyloct-6-ene-1,3-diol is sourced from PubChem (CID 19928742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).