C24H30O6 — CID 19928824
[7-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-oxo-4-propan-2-yloxychromen-3-yl] acetate (PubChem CID 19928824) has the molecular formula C24H30O6 and a molecular weight of 414.50 g/mol. Its IUPAC name is [7-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-oxo-4-propan-2-yloxychromen-3-yl] acetate.
| Compound Name | [7-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-oxo-4-propan-2-yloxychromen-3-yl] acetate |
|---|---|
| PubChem CID | 19928824 |
| Molecular Formula | C24H30O6 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | [7-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-oxo-4-propan-2-yloxychromen-3-yl] acetate |
| SMILES | CC(=O)Oc1c(OC(C)C)c2ccc(OC/C=C(\C)CCC=C(C)C)cc2oc1=O |
| InChI | InChI=1S/C24H30O6/c1-15(2)8-7-9-17(5)12-13-27-19-10-11-20-21(14-19)30-24(26)23(29-18(6)25)22(20)28-16(3)4/h8,10-12,14,16H,7,9,13H2,1-6H3/b17-12+ |
| InChIKey | QWPMUKVDGBVXQG-SFQUDFHCSA-N |
| XLogP | 5.58 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|