About 2-bromo-6-(5-chloro-1,3-benzothiazol-2-yl)-4-nitroaniline
2-bromo-6-(5-chloro-1,3-benzothiazol-2-yl)-4-nitroaniline (PubChem CID 19930358) has the molecular formula C13H7BrClN3O2S
and a molecular weight of 384.64 g/mol. Its IUPAC name is 2-bromo-6-(5-chloro-1,3-benzothiazol-2-yl)-4-nitroaniline.
Molecular Properties
| Compound Name | 2-bromo-6-(5-chloro-1,3-benzothiazol-2-yl)-4-nitroaniline |
| PubChem CID | 19930358 |
| Molecular Formula | C13H7BrClN3O2S |
| Molecular Weight | 384.64 g/mol |
| Exact Mass | 382.91 |
| IUPAC Name | 2-bromo-6-(5-chloro-1,3-benzothiazol-2-yl)-4-nitroaniline |
| SMILES | Nc1c(Br)cc([N+](=O)[O-])cc1-c1nc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C13H7BrClN3O2S/c14-9-5-7(18(19)20)4-8(12(9)16)13-17-10-3-6(15)1-2-11(10)21-13/h1-5H,16H2 |
| InChIKey | NUIDMKQEXTYGHS-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.64 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-6-(5-chloro-1,3-benzothiazol-2-yl)-4-nitroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6-(5-chloro-1,3-benzothiazol-2-yl)-4-nitroaniline?
The IUPAC name of 2-bromo-6-(5-chloro-1,3-benzothiazol-2-yl)-4-nitroaniline (CID 19930358) is 2-bromo-6-(5-chloro-1,3-benzothiazol-2-yl)-4-nitroaniline.
What is the SMILES notation for 2-bromo-6-(5-chloro-1,3-benzothiazol-2-yl)-4-nitroaniline?
The canonical SMILES for 2-bromo-6-(5-chloro-1,3-benzothiazol-2-yl)-4-nitroaniline is Nc1c(Br)cc([N+](=O)[O-])cc1-c1nc2cc(Cl)ccc2s1.
What is the InChIKey of 2-bromo-6-(5-chloro-1,3-benzothiazol-2-yl)-4-nitroaniline?
The InChIKey is NUIDMKQEXTYGHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7BrClN3O2S/c14-9-5-7(18(19)20)4-8(12(9)16)13-17-10-3-6(15)1-2-11(10)21-13/h1-5H,16H2.
What are the key properties of 2-bromo-6-(5-chloro-1,3-benzothiazol-2-yl)-4-nitroaniline?
2-bromo-6-(5-chloro-1,3-benzothiazol-2-yl)-4-nitroaniline has a molecular weight of 384.64 g/mol, XLogP of 4.87, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6-(5-chloro-1,3-benzothiazol-2-yl)-4-nitroaniline is sourced from PubChem (CID 19930358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).