C18H33N9 — CID 19930381
2-[1,2-bis(cyanomethyl)-1,4,7,10,13,16-hexazacyclooctadec-2-yl]acetonitrile (PubChem CID 19930381) has the molecular formula C18H33N9 and a molecular weight of 375.53 g/mol. Its IUPAC name is 2-[1,2-bis(cyanomethyl)-1,4,7,10,13,16-hexazacyclooctadec-2-yl]acetonitrile.
| Compound Name | 2-[1,2-bis(cyanomethyl)-1,4,7,10,13,16-hexazacyclooctadec-2-yl]acetonitrile |
|---|---|
| PubChem CID | 19930381 |
| Molecular Formula | C18H33N9 |
| Molecular Weight | 375.53 g/mol |
| Exact Mass | 375.29 |
| IUPAC Name | 2-[1,2-bis(cyanomethyl)-1,4,7,10,13,16-hexazacyclooctadec-2-yl]acetonitrile |
| SMILES | N#CCN1CCNCCNCCNCCNCCNCC1(CC#N)CC#N |
| InChI | InChI=1S/C18H33N9/c19-3-1-18(2-4-20)17-26-13-12-24-9-8-22-6-7-23-10-11-25-14-16-27(18)15-5-21/h22-26H,1-2,6-17H2 |
| InChIKey | KIQSUCXYIMIVDM-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.53 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|