C13H24F2O5Si — CID 19930561
3-(2,2-diethyl-1,3-dioxolan-4-yl)-2,2-difluoro-3-trimethylsilyloxypropanoic acid (PubChem CID 19930561) has the molecular formula C13H24F2O5Si and a molecular weight of 326.41 g/mol. Its IUPAC name is 3-(2,2-diethyl-1,3-dioxolan-4-yl)-2,2-difluoro-3-trimethylsilyloxypropanoic acid.
| Compound Name | 3-(2,2-diethyl-1,3-dioxolan-4-yl)-2,2-difluoro-3-trimethylsilyloxypropanoic acid |
|---|---|
| PubChem CID | 19930561 |
| Molecular Formula | C13H24F2O5Si |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 3-(2,2-diethyl-1,3-dioxolan-4-yl)-2,2-difluoro-3-trimethylsilyloxypropanoic acid |
| SMILES | CCC1(CC)OCC(C(O[Si](C)(C)C)C(F)(F)C(=O)O)O1 |
| InChI | InChI=1S/C13H24F2O5Si/c1-6-12(7-2)18-8-9(19-12)10(20-21(3,4)5)13(14,15)11(16)17/h9-10H,6-8H2,1-5H3,(H,16,17) |
| InChIKey | AUYPXCXWWVJJBN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|