About 1-hydrazinylethanamine
1-hydrazinylethanamine (PubChem CID 19930590) has the molecular formula C2H9N3
and a molecular weight of 75.11 g/mol. Its IUPAC name is 1-hydrazinylethanamine.
Molecular Properties
| Compound Name | 1-hydrazinylethanamine |
| PubChem CID | 19930590 |
| Molecular Formula | C2H9N3 |
| Molecular Weight | 75.11 g/mol |
| Exact Mass | 75.08 |
| IUPAC Name | 1-hydrazinylethanamine |
| SMILES | CC(N)NN |
| InChI | InChI=1S/C2H9N3/c1-2(3)5-4/h2,5H,3-4H2,1H3 |
| InChIKey | YBOOTEPRBQZLHP-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 75.11 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-hydrazinylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydrazinylethanamine?
The IUPAC name of 1-hydrazinylethanamine (CID 19930590) is 1-hydrazinylethanamine.
What is the SMILES notation for 1-hydrazinylethanamine?
The canonical SMILES for 1-hydrazinylethanamine is CC(N)NN.
What is the InChIKey of 1-hydrazinylethanamine?
The InChIKey is YBOOTEPRBQZLHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H9N3/c1-2(3)5-4/h2,5H,3-4H2,1H3.
What are the key properties of 1-hydrazinylethanamine?
1-hydrazinylethanamine has a molecular weight of 75.11 g/mol, XLogP of -1.25, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydrazinylethanamine is sourced from PubChem (CID 19930590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).