C11H15N5 — CID 19931
6,6-dimethyl-1-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 19931) has the molecular formula C11H15N5 and a molecular weight of 217.28 g/mol. Its IUPAC name is 6,6-dimethyl-1-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6,6-dimethyl-1-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 19931 |
| Molecular Formula | C11H15N5 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 6,6-dimethyl-1-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | CC1(C)N=C(N)N=C(N)N1c1ccccc1 |
| InChI | InChI=1S/C11H15N5/c1-11(2)15-9(12)14-10(13)16(11)8-6-4-3-5-7-8/h3-7H,1-2H3,(H4,12,13,14,15) |
| InChIKey | VMVKLCXTXSSZSI-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |