C7H6F11NO2S — CID 19931110
N-ethyl-1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane-1-sulfonamide (PubChem CID 19931110) has the molecular formula C7H6F11NO2S and a molecular weight of 377.18 g/mol. Its IUPAC name is N-ethyl-1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane-1-sulfonamide.
| Compound Name | N-ethyl-1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane-1-sulfonamide |
|---|---|
| PubChem CID | 19931110 |
| Molecular Formula | C7H6F11NO2S |
| Molecular Weight | 377.18 g/mol |
| Exact Mass | 376.99 |
| IUPAC Name | N-ethyl-1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane-1-sulfonamide |
| SMILES | CCNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H6F11NO2S/c1-2-19-22(20,21)7(17,18)5(12,13)3(8,9)4(10,11)6(14,15)16/h19H,2H2,1H3 |
| InChIKey | RUIVGYDYVAXAHW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.18 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|