C35H16F16O10 — CID 19931483
4-[4-[5-[4-[3,4-dicarboxy-2-(trifluoromethyl)phenoxy]phenyl]-1,1,2,2,3,3,4,4,5,5-decafluoropentyl]phenoxy]-3-(trifluoromethyl)phthalic acid (PubChem CID 19931483) has the molecular formula C35H16F16O10 and a molecular weight of 900.47 g/mol. Its IUPAC name is 4-[4-[5-[4-[3,4-dicarboxy-2-(trifluoromethyl)phenoxy]phenyl]-1,1,2,2,3,3,4,4,5,5-decafluoropentyl]phenoxy]-3-(trifluoromethyl)phthalic acid.
| Compound Name | 4-[4-[5-[4-[3,4-dicarboxy-2-(trifluoromethyl)phenoxy]phenyl]-1,1,2,2,3,3,4,4,5,5-decafluoropentyl]phenoxy]-3-(trifluoromethyl)phthalic acid |
|---|---|
| PubChem CID | 19931483 |
| Molecular Formula | C35H16F16O10 |
| Molecular Weight | 900.47 g/mol |
| Exact Mass | 900.05 |
| IUPAC Name | 4-[4-[5-[4-[3,4-dicarboxy-2-(trifluoromethyl)phenoxy]phenyl]-1,1,2,2,3,3,4,4,5,5-decafluoropentyl]phenoxy]-3-(trifluoromethyl)phthalic acid |
| SMILES | O=C(O)c1ccc(Oc2ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)c3ccc(Oc4ccc(C(=O)O)c(C(=O)O)c4C(F)(F)F)cc3)cc2)c(C(F)(F)F)c1C(=O)O |
| InChI | InChI=1S/C35H16F16O10/c36-29(37,13-1-5-15(6-2-13)60-19-11-9-17(25(52)53)21(27(56)57)23(19)31(40,41)42)33(46,47)35(50,51)34(48,49)30(38,39)14-3-7-16(8-4-14)61-20-12-10-18(26(54)55)22(28(58)59)24(20)32(43,44)45/h1-12H,(H,52,53)(H,54,55)(H,56,57)(H,58,59) |
| InChIKey | VAUGJMBVFPVGSK-UHFFFAOYSA-N |
| XLogP | 10.89 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 900.47 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|