C12H20O7S-2 — CID 19931599
2-octyl-2-sulfobutanedioate (PubChem CID 19931599) has the molecular formula C12H20O7S-2 and a molecular weight of 308.35 g/mol. Its IUPAC name is 2-octyl-2-sulfobutanedioate.
| Compound Name | 2-octyl-2-sulfobutanedioate |
|---|---|
| PubChem CID | 19931599 |
| Molecular Formula | C12H20O7S-2 |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-octyl-2-sulfobutanedioate |
| SMILES | CCCCCCCCC(CC(=O)[O-])(C(=O)[O-])S(=O)(=O)O |
| InChI | InChI=1S/C12H22O7S/c1-2-3-4-5-6-7-8-12(11(15)16,9-10(13)14)20(17,18)19/h2-9H2,1H3,(H,13,14)(H,15,16)(H,17,18,19)/p-2 |
| InChIKey | PLSGGINGUAWQKC-UHFFFAOYSA-L |
| XLogP | -0.75 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|