About 2-(1,2-benzoxazol-2-ium-2-yl)ethanol tetrafluoroborate
2-(1,2-benzoxazol-2-ium-2-yl)ethanol tetrafluoroborate (PubChem CID 19931754) has the molecular formula C9H10BF4NO2
and a molecular weight of 250.99 g/mol. Its IUPAC name is 2-(1,2-benzoxazol-2-ium-2-yl)ethanol tetrafluoroborate.
Molecular Properties
| Compound Name | 2-(1,2-benzoxazol-2-ium-2-yl)ethanol tetrafluoroborate |
| PubChem CID | 19931754 |
| Molecular Formula | C9H10BF4NO2 |
| Molecular Weight | 250.99 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 2-(1,2-benzoxazol-2-ium-2-yl)ethanol tetrafluoroborate |
| SMILES | F[B-](F)(F)F.OCC[n+]1cc2ccccc2o1 |
| InChI | InChI=1S/C9H10NO2.BF4/c11-6-5-10-7-8-3-1-2-4-9(8)12-10;2-1(3,4)5/h1-4,7,11H,5-6H2;/q+1;-1 |
| InChIKey | VLPKFBPXILSOCH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 37.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.99 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,2-benzoxazol-2-ium-2-yl)ethanol tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2-benzoxazol-2-ium-2-yl)ethanol tetrafluoroborate?
The IUPAC name of 2-(1,2-benzoxazol-2-ium-2-yl)ethanol tetrafluoroborate (CID 19931754) is 2-(1,2-benzoxazol-2-ium-2-yl)ethanol tetrafluoroborate.
What is the SMILES notation for 2-(1,2-benzoxazol-2-ium-2-yl)ethanol tetrafluoroborate?
The canonical SMILES for 2-(1,2-benzoxazol-2-ium-2-yl)ethanol tetrafluoroborate is F[B-](F)(F)F.OCC[n+]1cc2ccccc2o1.
What is the InChIKey of 2-(1,2-benzoxazol-2-ium-2-yl)ethanol tetrafluoroborate?
The InChIKey is VLPKFBPXILSOCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10NO2.BF4/c11-6-5-10-7-8-3-1-2-4-9(8)12-10;2-1(3,4)5/h1-4,7,11H,5-6H2;/q+1;-1.
What are the key properties of 2-(1,2-benzoxazol-2-ium-2-yl)ethanol tetrafluoroborate?
2-(1,2-benzoxazol-2-ium-2-yl)ethanol tetrafluoroborate has a molecular weight of 250.99 g/mol, XLogP of 2.01, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2-benzoxazol-2-ium-2-yl)ethanol tetrafluoroborate is sourced from PubChem (CID 19931754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).