About 4-bromo-N,N-diethyl-3-[4-fluoro-3-(trifluoromethyl)phenyl]sulfanylpyrazole-1-carboxamide
4-bromo-N,N-diethyl-3-[4-fluoro-3-(trifluoromethyl)phenyl]sulfanylpyrazole-1-carboxamide (PubChem CID 19931807) has the molecular formula C15H14BrF4N3OS
and a molecular weight of 440.26 g/mol. Its IUPAC name is 4-bromo-N,N-diethyl-3-[4-fluoro-3-(trifluoromethyl)phenyl]sulfanylpyrazole-1-carboxamide.
Molecular Properties
| Compound Name | 4-bromo-N,N-diethyl-3-[4-fluoro-3-(trifluoromethyl)phenyl]sulfanylpyrazole-1-carboxamide |
| PubChem CID | 19931807 |
| Molecular Formula | C15H14BrF4N3OS |
| Molecular Weight | 440.26 g/mol |
| Exact Mass | 439.00 |
| IUPAC Name | 4-bromo-N,N-diethyl-3-[4-fluoro-3-(trifluoromethyl)phenyl]sulfanylpyrazole-1-carboxamide |
| SMILES | CCN(CC)C(=O)n1cc(Br)c(Sc2ccc(F)c(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C15H14BrF4N3OS/c1-3-22(4-2)14(24)23-8-11(16)13(21-23)25-9-5-6-12(17)10(7-9)15(18,19)20/h5-8H,3-4H2,1-2H3 |
| InChIKey | QJLOLLSTGCAEFR-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.26 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-bromo-N,N-diethyl-3-[4-fluoro-3-(trifluoromethyl)phenyl]sulfanylpyrazole-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N,N-diethyl-3-[4-fluoro-3-(trifluoromethyl)phenyl]sulfanylpyrazole-1-carboxamide?
The IUPAC name of 4-bromo-N,N-diethyl-3-[4-fluoro-3-(trifluoromethyl)phenyl]sulfanylpyrazole-1-carboxamide (CID 19931807) is 4-bromo-N,N-diethyl-3-[4-fluoro-3-(trifluoromethyl)phenyl]sulfanylpyrazole-1-carboxamide.
What is the SMILES notation for 4-bromo-N,N-diethyl-3-[4-fluoro-3-(trifluoromethyl)phenyl]sulfanylpyrazole-1-carboxamide?
The canonical SMILES for 4-bromo-N,N-diethyl-3-[4-fluoro-3-(trifluoromethyl)phenyl]sulfanylpyrazole-1-carboxamide is CCN(CC)C(=O)n1cc(Br)c(Sc2ccc(F)c(C(F)(F)F)c2)n1.
What is the InChIKey of 4-bromo-N,N-diethyl-3-[4-fluoro-3-(trifluoromethyl)phenyl]sulfanylpyrazole-1-carboxamide?
The InChIKey is QJLOLLSTGCAEFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14BrF4N3OS/c1-3-22(4-2)14(24)23-8-11(16)13(21-23)25-9-5-6-12(17)10(7-9)15(18,19)20/h5-8H,3-4H2,1-2H3.
What are the key properties of 4-bromo-N,N-diethyl-3-[4-fluoro-3-(trifluoromethyl)phenyl]sulfanylpyrazole-1-carboxamide?
4-bromo-N,N-diethyl-3-[4-fluoro-3-(trifluoromethyl)phenyl]sulfanylpyrazole-1-carboxamide has a molecular weight of 440.26 g/mol, XLogP of 5.26, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N,N-diethyl-3-[4-fluoro-3-(trifluoromethyl)phenyl]sulfanylpyrazole-1-carboxamide is sourced from PubChem (CID 19931807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).