About N-butyl-4-chloro-3-(2,4-difluorophenyl)sulfanyl-N-methylpyrazole-1-carboxamide
N-butyl-4-chloro-3-(2,4-difluorophenyl)sulfanyl-N-methylpyrazole-1-carboxamide (PubChem CID 19932218) has the molecular formula C15H16ClF2N3OS
and a molecular weight of 359.83 g/mol. Its IUPAC name is N-butyl-4-chloro-3-(2,4-difluorophenyl)sulfanyl-N-methylpyrazole-1-carboxamide.
Molecular Properties
| Compound Name | N-butyl-4-chloro-3-(2,4-difluorophenyl)sulfanyl-N-methylpyrazole-1-carboxamide |
| PubChem CID | 19932218 |
| Molecular Formula | C15H16ClF2N3OS |
| Molecular Weight | 359.83 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | N-butyl-4-chloro-3-(2,4-difluorophenyl)sulfanyl-N-methylpyrazole-1-carboxamide |
| SMILES | CCCCN(C)C(=O)n1cc(Cl)c(Sc2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C15H16ClF2N3OS/c1-3-4-7-20(2)15(22)21-9-11(16)14(19-21)23-13-6-5-10(17)8-12(13)18/h5-6,8-9H,3-4,7H2,1-2H3 |
| InChIKey | OPGZJVDKCWEGIY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.83 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-butyl-4-chloro-3-(2,4-difluorophenyl)sulfanyl-N-methylpyrazole-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-4-chloro-3-(2,4-difluorophenyl)sulfanyl-N-methylpyrazole-1-carboxamide?
The IUPAC name of N-butyl-4-chloro-3-(2,4-difluorophenyl)sulfanyl-N-methylpyrazole-1-carboxamide (CID 19932218) is N-butyl-4-chloro-3-(2,4-difluorophenyl)sulfanyl-N-methylpyrazole-1-carboxamide.
What is the SMILES notation for N-butyl-4-chloro-3-(2,4-difluorophenyl)sulfanyl-N-methylpyrazole-1-carboxamide?
The canonical SMILES for N-butyl-4-chloro-3-(2,4-difluorophenyl)sulfanyl-N-methylpyrazole-1-carboxamide is CCCCN(C)C(=O)n1cc(Cl)c(Sc2ccc(F)cc2F)n1.
What is the InChIKey of N-butyl-4-chloro-3-(2,4-difluorophenyl)sulfanyl-N-methylpyrazole-1-carboxamide?
The InChIKey is OPGZJVDKCWEGIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16ClF2N3OS/c1-3-4-7-20(2)15(22)21-9-11(16)14(19-21)23-13-6-5-10(17)8-12(13)18/h5-6,8-9H,3-4,7H2,1-2H3.
What are the key properties of N-butyl-4-chloro-3-(2,4-difluorophenyl)sulfanyl-N-methylpyrazole-1-carboxamide?
N-butyl-4-chloro-3-(2,4-difluorophenyl)sulfanyl-N-methylpyrazole-1-carboxamide has a molecular weight of 359.83 g/mol, XLogP of 4.67, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-4-chloro-3-(2,4-difluorophenyl)sulfanyl-N-methylpyrazole-1-carboxamide is sourced from PubChem (CID 19932218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).