C17H15Cl2N3O2S — CID 19932870
propan-2-yl 3-(2,6-dichlorophenyl)-2-sulfanylidene-1,3-dihydropyrido[2,3-b]pyrazine-4-carboxylate (PubChem CID 19932870) has the molecular formula C17H15Cl2N3O2S and a molecular weight of 396.30 g/mol. Its IUPAC name is propan-2-yl 3-(2,6-dichlorophenyl)-2-sulfanylidene-1,3-dihydropyrido[2,3-b]pyrazine-4-carboxylate.
| Compound Name | propan-2-yl 3-(2,6-dichlorophenyl)-2-sulfanylidene-1,3-dihydropyrido[2,3-b]pyrazine-4-carboxylate |
|---|---|
| PubChem CID | 19932870 |
| Molecular Formula | C17H15Cl2N3O2S |
| Molecular Weight | 396.30 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | propan-2-yl 3-(2,6-dichlorophenyl)-2-sulfanylidene-1,3-dihydropyrido[2,3-b]pyrazine-4-carboxylate |
| SMILES | CC(C)OC(=O)N1c2ncccc2NC(=S)C1c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H15Cl2N3O2S/c1-9(2)24-17(23)22-14(13-10(18)5-3-6-11(13)19)16(25)21-12-7-4-8-20-15(12)22/h3-9,14H,1-2H3,(H,21,25) |
| InChIKey | DZGGQYRMTMIMOU-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.30 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|