About 2-(4-methyl-1,3-thiazol-2-yl)oxan-4-ol
2-(4-methyl-1,3-thiazol-2-yl)oxan-4-ol (PubChem CID 19933016) has the molecular formula C9H13NO2S
and a molecular weight of 199.27 g/mol. Its IUPAC name is 2-(4-methyl-1,3-thiazol-2-yl)oxan-4-ol.
Molecular Properties
| Compound Name | 2-(4-methyl-1,3-thiazol-2-yl)oxan-4-ol |
| PubChem CID | 19933016 |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 2-(4-methyl-1,3-thiazol-2-yl)oxan-4-ol |
| SMILES | Cc1csc(C2CC(O)CCO2)n1 |
| InChI | InChI=1S/C9H13NO2S/c1-6-5-13-9(10-6)8-4-7(11)2-3-12-8/h5,7-8,11H,2-4H2,1H3 |
| InChIKey | LSPBNMOVTGONAJ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-methyl-1,3-thiazol-2-yl)oxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-1,3-thiazol-2-yl)oxan-4-ol?
The IUPAC name of 2-(4-methyl-1,3-thiazol-2-yl)oxan-4-ol (CID 19933016) is 2-(4-methyl-1,3-thiazol-2-yl)oxan-4-ol.
What is the SMILES notation for 2-(4-methyl-1,3-thiazol-2-yl)oxan-4-ol?
The canonical SMILES for 2-(4-methyl-1,3-thiazol-2-yl)oxan-4-ol is Cc1csc(C2CC(O)CCO2)n1.
What is the InChIKey of 2-(4-methyl-1,3-thiazol-2-yl)oxan-4-ol?
The InChIKey is LSPBNMOVTGONAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2S/c1-6-5-13-9(10-6)8-4-7(11)2-3-12-8/h5,7-8,11H,2-4H2,1H3.
What are the key properties of 2-(4-methyl-1,3-thiazol-2-yl)oxan-4-ol?
2-(4-methyl-1,3-thiazol-2-yl)oxan-4-ol has a molecular weight of 199.27 g/mol, XLogP of 1.66, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-1,3-thiazol-2-yl)oxan-4-ol is sourced from PubChem (CID 19933016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).