About 1H-pyrazole-4,5-dicarbaldehyde
1H-pyrazole-4,5-dicarbaldehyde (PubChem CID 19933051) has the molecular formula C5H4N2O2
and a molecular weight of 124.10 g/mol. Its IUPAC name is 1H-pyrazole-4,5-dicarbaldehyde.
Molecular Properties
| Compound Name | 1H-pyrazole-4,5-dicarbaldehyde |
| PubChem CID | 19933051 |
| Molecular Formula | C5H4N2O2 |
| Molecular Weight | 124.10 g/mol |
| Exact Mass | 124.03 |
| IUPAC Name | 1H-pyrazole-4,5-dicarbaldehyde |
| SMILES | O=Cc1cn[nH]c1C=O |
| InChI | InChI=1S/C5H4N2O2/c8-2-4-1-6-7-5(4)3-9/h1-3H,(H,6,7) |
| InChIKey | TXXFIWSYDDTMBU-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.10 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1H-pyrazole-4,5-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrazole-4,5-dicarbaldehyde?
The IUPAC name of 1H-pyrazole-4,5-dicarbaldehyde (CID 19933051) is 1H-pyrazole-4,5-dicarbaldehyde.
What is the SMILES notation for 1H-pyrazole-4,5-dicarbaldehyde?
The canonical SMILES for 1H-pyrazole-4,5-dicarbaldehyde is O=Cc1cn[nH]c1C=O.
What is the InChIKey of 1H-pyrazole-4,5-dicarbaldehyde?
The InChIKey is TXXFIWSYDDTMBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O2/c8-2-4-1-6-7-5(4)3-9/h1-3H,(H,6,7).
What are the key properties of 1H-pyrazole-4,5-dicarbaldehyde?
1H-pyrazole-4,5-dicarbaldehyde has a molecular weight of 124.10 g/mol, XLogP of 0.03, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrazole-4,5-dicarbaldehyde is sourced from PubChem (CID 19933051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).