About tris(rubidium(1+));arsorite
tris(rubidium(1+));arsorite (PubChem CID 19933053) has the molecular formula AsO3Rb3
and a molecular weight of 379.32 g/mol. Its IUPAC name is tris(rubidium(1+));arsorite.
Molecular Properties
| Compound Name | tris(rubidium(1+));arsorite |
| PubChem CID | 19933053 |
| Molecular Formula | AsO3Rb3 |
| Molecular Weight | 379.32 g/mol |
| Exact Mass | 377.64 |
| IUPAC Name | tris(rubidium(1+));arsorite |
| SMILES | [O-][As]([O-])[O-].[Rb+].[Rb+].[Rb+] |
| InChI | InChI=1S/AsO3.3Rb/c2-1(3)4;;;/q-3;3*+1 |
| InChIKey | BUIPTFAVQPBALA-UHFFFAOYSA-N |
| XLogP | -12.94 |
| TPSA | 69.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.32 |
| LogP ≤ 5 | -12.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tris(rubidium(1+));arsorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(rubidium(1+));arsorite?
The IUPAC name of tris(rubidium(1+));arsorite (CID 19933053) is tris(rubidium(1+));arsorite.
What is the SMILES notation for tris(rubidium(1+));arsorite?
The canonical SMILES for tris(rubidium(1+));arsorite is [O-][As]([O-])[O-].[Rb+].[Rb+].[Rb+].
What is the InChIKey of tris(rubidium(1+));arsorite?
The InChIKey is BUIPTFAVQPBALA-UHFFFAOYSA-N. The full InChI is InChI=1S/AsO3.3Rb/c2-1(3)4;;;/q-3;3*+1.
What are the key properties of tris(rubidium(1+));arsorite?
tris(rubidium(1+));arsorite has a molecular weight of 379.32 g/mol, XLogP of -12.94, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tris(rubidium(1+));arsorite is sourced from PubChem (CID 19933053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).