C29H38N2O7SSi — CID 19933349
2-nitro-3-oxabicyclo[4.2.2]deca-1(8),6,9-trien-4-one;S-phenyl 2-[2-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-3-yl]propanethioate (PubChem CID 19933349) has the molecular formula C29H38N2O7SSi and a molecular weight of 586.78 g/mol. Its IUPAC name is 2-nitro-3-oxabicyclo[4.2.2]deca-1(8),6,9-trien-4-one;S-phenyl 2-[2-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-3-yl]propanethioate.
| Compound Name | 2-nitro-3-oxabicyclo[4.2.2]deca-1(8),6,9-trien-4-one;S-phenyl 2-[2-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-3-yl]propanethioate |
|---|---|
| PubChem CID | 19933349 |
| Molecular Formula | C29H38N2O7SSi |
| Molecular Weight | 586.78 g/mol |
| Exact Mass | 586.22 |
| IUPAC Name | 2-nitro-3-oxabicyclo[4.2.2]deca-1(8),6,9-trien-4-one;S-phenyl 2-[2-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-3-yl]propanethioate |
| SMILES | CC(O[Si](C)(C)C(C)(C)C)C1NC(=O)C1C(C)C(=O)Sc1ccccc1.O=C1Cc2ccc(cc2)C([N+](=O)[O-])O1 |
| InChI | InChI=1S/C20H31NO3SSi.C9H7NO4/c1-13(19(23)25-15-11-9-8-10-12-15)16-17(21-18(16)22)14(2)24-26(6,7)20(3,4)5;11-8-5-6-1-3-7(4-2-6)9(14-8)10(12)13/h8-14,16-17H,1-7H3,(H,21,22);1-4,9H,5H2 |
| InChIKey | HQFHFWOXNSPYQO-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.78 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|