C18H31O3P — CID 19933559
2-[(1E,3E)-5-[ethoxy(methoxy)phosphoryl]-3-methylpenta-1,3-dienyl]-1,3,3-trimethylcyclohexene (PubChem CID 19933559) has the molecular formula C18H31O3P and a molecular weight of 326.42 g/mol. Its IUPAC name is 2-[(1E,3E)-5-[ethoxy(methoxy)phosphoryl]-3-methylpenta-1,3-dienyl]-1,3,3-trimethylcyclohexene.
| Compound Name | 2-[(1E,3E)-5-[ethoxy(methoxy)phosphoryl]-3-methylpenta-1,3-dienyl]-1,3,3-trimethylcyclohexene |
|---|---|
| PubChem CID | 19933559 |
| Molecular Formula | C18H31O3P |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 2-[(1E,3E)-5-[ethoxy(methoxy)phosphoryl]-3-methylpenta-1,3-dienyl]-1,3,3-trimethylcyclohexene |
| SMILES | CCOP(=O)(C/C=C(C)/C=C/C1=C(C)CCCC1(C)C)OC |
| InChI | InChI=1S/C18H31O3P/c1-7-21-22(19,20-6)14-12-15(2)10-11-17-16(3)9-8-13-18(17,4)5/h10-12H,7-9,13-14H2,1-6H3/b11-10+,15-12+ |
| InChIKey | FYOYMLDNIDIBHF-GCHFJXRNSA-N |
| XLogP | 5.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|