About (2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)thallium
(2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)thallium (PubChem CID 19933625) has the molecular formula C10H15Tl
and a molecular weight of 339.61 g/mol. Its IUPAC name is (2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)thallium.
Analyze (2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)thallium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)thallium?
The IUPAC name of (2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)thallium (CID 19933625) is (2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)thallium.
What is the SMILES notation for (2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)thallium?
The canonical SMILES for (2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)thallium is CC1=C(C)C(C)(C)C([Tl])=C1C.
What is the InChIKey of (2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)thallium?
The InChIKey is RPNIFYSSJFUXIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15.Tl/c1-7-6-10(4,5)9(3)8(7)2;/h1-5H3;.
What are the key properties of (2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)thallium?
(2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)thallium has a molecular weight of 339.61 g/mol, XLogP of 2.81, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)thallium is sourced from PubChem (CID 19933625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).