About N-(2,2-dimethylpropyl)-N',N'-dimethylprop-2-enehydrazide
N-(2,2-dimethylpropyl)-N',N'-dimethylprop-2-enehydrazide (PubChem CID 19933790) has the molecular formula C10H20N2O
and a molecular weight of 184.28 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)-N',N'-dimethylprop-2-enehydrazide.
Molecular Properties
| Compound Name | N-(2,2-dimethylpropyl)-N',N'-dimethylprop-2-enehydrazide |
| PubChem CID | 19933790 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | N-(2,2-dimethylpropyl)-N',N'-dimethylprop-2-enehydrazide |
| SMILES | C=CC(=O)N(CC(C)(C)C)N(C)C |
| InChI | InChI=1S/C10H20N2O/c1-7-9(13)12(11(5)6)8-10(2,3)4/h7H,1,8H2,2-6H3 |
| InChIKey | LYDDHZFBGNQJTB-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2,2-dimethylpropyl)-N',N'-dimethylprop-2-enehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-dimethylpropyl)-N',N'-dimethylprop-2-enehydrazide?
The IUPAC name of N-(2,2-dimethylpropyl)-N',N'-dimethylprop-2-enehydrazide (CID 19933790) is N-(2,2-dimethylpropyl)-N',N'-dimethylprop-2-enehydrazide.
What is the SMILES notation for N-(2,2-dimethylpropyl)-N',N'-dimethylprop-2-enehydrazide?
The canonical SMILES for N-(2,2-dimethylpropyl)-N',N'-dimethylprop-2-enehydrazide is C=CC(=O)N(CC(C)(C)C)N(C)C.
What is the InChIKey of N-(2,2-dimethylpropyl)-N',N'-dimethylprop-2-enehydrazide?
The InChIKey is LYDDHZFBGNQJTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O/c1-7-9(13)12(11(5)6)8-10(2,3)4/h7H,1,8H2,2-6H3.
What are the key properties of N-(2,2-dimethylpropyl)-N',N'-dimethylprop-2-enehydrazide?
N-(2,2-dimethylpropyl)-N',N'-dimethylprop-2-enehydrazide has a molecular weight of 184.28 g/mol, XLogP of 1.52, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-dimethylpropyl)-N',N'-dimethylprop-2-enehydrazide is sourced from PubChem (CID 19933790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).