About icos-19-ene-1,1,10-triol
icos-19-ene-1,1,10-triol (PubChem CID 19933797) has the molecular formula C20H40O3
and a molecular weight of 328.54 g/mol. Its IUPAC name is icos-19-ene-1,1,10-triol.
Molecular Properties
| Compound Name | icos-19-ene-1,1,10-triol |
| PubChem CID | 19933797 |
| Molecular Formula | C20H40O3 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.30 |
| IUPAC Name | icos-19-ene-1,1,10-triol |
| SMILES | C=CCCCCCCCCC(O)CCCCCCCCC(O)O |
| InChI | InChI=1S/C20H40O3/c1-2-3-4-5-6-7-10-13-16-19(21)17-14-11-8-9-12-15-18-20(22)23/h2,19-23H,1,3-18H2 |
| InChIKey | GHNAKYABDQEYCO-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze icos-19-ene-1,1,10-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of icos-19-ene-1,1,10-triol?
The IUPAC name of icos-19-ene-1,1,10-triol (CID 19933797) is icos-19-ene-1,1,10-triol.
What is the SMILES notation for icos-19-ene-1,1,10-triol?
The canonical SMILES for icos-19-ene-1,1,10-triol is C=CCCCCCCCCC(O)CCCCCCCCC(O)O.
What is the InChIKey of icos-19-ene-1,1,10-triol?
The InChIKey is GHNAKYABDQEYCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H40O3/c1-2-3-4-5-6-7-10-13-16-19(21)17-14-11-8-9-12-15-18-20(22)23/h2,19-23H,1,3-18H2.
What are the key properties of icos-19-ene-1,1,10-triol?
icos-19-ene-1,1,10-triol has a molecular weight of 328.54 g/mol, XLogP of 5.09, 18 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for icos-19-ene-1,1,10-triol is sourced from PubChem (CID 19933797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).