About 2-ethyl-1,2-benzoxazol-2-ium-7-ol tritetrafluoroborate
2-ethyl-1,2-benzoxazol-2-ium-7-ol tritetrafluoroborate (PubChem CID 19934149) has the molecular formula C9H10B3F12NO2-2
and a molecular weight of 424.60 g/mol. Its IUPAC name is 2-ethyl-1,2-benzoxazol-2-ium-7-ol tritetrafluoroborate.
Molecular Properties
| Compound Name | 2-ethyl-1,2-benzoxazol-2-ium-7-ol tritetrafluoroborate |
| PubChem CID | 19934149 |
| Molecular Formula | C9H10B3F12NO2-2 |
| Molecular Weight | 424.60 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 2-ethyl-1,2-benzoxazol-2-ium-7-ol tritetrafluoroborate |
| SMILES | CC[n+]1cc2cccc(O)c2o1.F[B-](F)(F)F.F[B-](F)(F)F.F[B-](F)(F)F |
| InChI | InChI=1S/C9H9NO2.3BF4/c1-2-10-6-7-4-3-5-8(11)9(7)12-10;3*2-1(3,4)5/h3-6H,2H2,1H3;;;/q;3*-1/p+1 |
| InChIKey | WDRPNVKTISAXGI-UHFFFAOYSA-O |
| XLogP | 5.35 |
| TPSA | 37.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.60 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-1,2-benzoxazol-2-ium-7-ol tritetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1,2-benzoxazol-2-ium-7-ol tritetrafluoroborate?
The IUPAC name of 2-ethyl-1,2-benzoxazol-2-ium-7-ol tritetrafluoroborate (CID 19934149) is 2-ethyl-1,2-benzoxazol-2-ium-7-ol tritetrafluoroborate.
What is the SMILES notation for 2-ethyl-1,2-benzoxazol-2-ium-7-ol tritetrafluoroborate?
The canonical SMILES for 2-ethyl-1,2-benzoxazol-2-ium-7-ol tritetrafluoroborate is CC[n+]1cc2cccc(O)c2o1.F[B-](F)(F)F.F[B-](F)(F)F.F[B-](F)(F)F.
What is the InChIKey of 2-ethyl-1,2-benzoxazol-2-ium-7-ol tritetrafluoroborate?
The InChIKey is WDRPNVKTISAXGI-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H9NO2.3BF4/c1-2-10-6-7-4-3-5-8(11)9(7)12-10;3*2-1(3,4)5/h3-6H,2H2,1H3;;;/q;3*-1/p+1.
What are the key properties of 2-ethyl-1,2-benzoxazol-2-ium-7-ol tritetrafluoroborate?
2-ethyl-1,2-benzoxazol-2-ium-7-ol tritetrafluoroborate has a molecular weight of 424.60 g/mol, XLogP of 5.35, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1,2-benzoxazol-2-ium-7-ol tritetrafluoroborate is sourced from PubChem (CID 19934149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).