About 2-ethyl-1,2-benzoxazol-2-ium-7-ol
2-ethyl-1,2-benzoxazol-2-ium-7-ol (PubChem CID 19934150) has the molecular formula C9H10NO2+
and a molecular weight of 164.18 g/mol. Its IUPAC name is 2-ethyl-1,2-benzoxazol-2-ium-7-ol.
Molecular Properties
| Compound Name | 2-ethyl-1,2-benzoxazol-2-ium-7-ol |
| PubChem CID | 19934150 |
| Molecular Formula | C9H10NO2+ |
| Molecular Weight | 164.18 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 2-ethyl-1,2-benzoxazol-2-ium-7-ol |
| SMILES | CC[n+]1cc2cccc(O)c2o1 |
| InChI | InChI=1S/C9H9NO2/c1-2-10-6-7-4-3-5-8(11)9(7)12-10/h3-6H,2H2,1H3/p+1 |
| InChIKey | AVZBOAGCVKEESJ-UHFFFAOYSA-O |
| XLogP | 1.45 |
| TPSA | 37.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.18 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-1,2-benzoxazol-2-ium-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1,2-benzoxazol-2-ium-7-ol?
The IUPAC name of 2-ethyl-1,2-benzoxazol-2-ium-7-ol (CID 19934150) is 2-ethyl-1,2-benzoxazol-2-ium-7-ol.
What is the SMILES notation for 2-ethyl-1,2-benzoxazol-2-ium-7-ol?
The canonical SMILES for 2-ethyl-1,2-benzoxazol-2-ium-7-ol is CC[n+]1cc2cccc(O)c2o1.
What is the InChIKey of 2-ethyl-1,2-benzoxazol-2-ium-7-ol?
The InChIKey is AVZBOAGCVKEESJ-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H9NO2/c1-2-10-6-7-4-3-5-8(11)9(7)12-10/h3-6H,2H2,1H3/p+1.
What are the key properties of 2-ethyl-1,2-benzoxazol-2-ium-7-ol?
2-ethyl-1,2-benzoxazol-2-ium-7-ol has a molecular weight of 164.18 g/mol, XLogP of 1.45, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1,2-benzoxazol-2-ium-7-ol is sourced from PubChem (CID 19934150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).