About 3,5-ditert-butyl-2,4,6-trimethylphenol
3,5-ditert-butyl-2,4,6-trimethylphenol (PubChem CID 19934176) has the molecular formula C17H28O
and a molecular weight of 248.41 g/mol. Its IUPAC name is 3,5-ditert-butyl-2,4,6-trimethylphenol.
Molecular Properties
| Compound Name | 3,5-ditert-butyl-2,4,6-trimethylphenol |
| PubChem CID | 19934176 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | 3,5-ditert-butyl-2,4,6-trimethylphenol |
| SMILES | Cc1c(O)c(C)c(C(C)(C)C)c(C)c1C(C)(C)C |
| InChI | InChI=1S/C17H28O/c1-10-13(16(4,5)6)11(2)15(18)12(3)14(10)17(7,8)9/h18H,1-9H3 |
| InChIKey | LDJJCBOCIYKJAR-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,5-ditert-butyl-2,4,6-trimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-ditert-butyl-2,4,6-trimethylphenol?
The IUPAC name of 3,5-ditert-butyl-2,4,6-trimethylphenol (CID 19934176) is 3,5-ditert-butyl-2,4,6-trimethylphenol.
What is the SMILES notation for 3,5-ditert-butyl-2,4,6-trimethylphenol?
The canonical SMILES for 3,5-ditert-butyl-2,4,6-trimethylphenol is Cc1c(O)c(C)c(C(C)(C)C)c(C)c1C(C)(C)C.
What is the InChIKey of 3,5-ditert-butyl-2,4,6-trimethylphenol?
The InChIKey is LDJJCBOCIYKJAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O/c1-10-13(16(4,5)6)11(2)15(18)12(3)14(10)17(7,8)9/h18H,1-9H3.
What are the key properties of 3,5-ditert-butyl-2,4,6-trimethylphenol?
3,5-ditert-butyl-2,4,6-trimethylphenol has a molecular weight of 248.41 g/mol, XLogP of 4.91, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-ditert-butyl-2,4,6-trimethylphenol is sourced from PubChem (CID 19934176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).