About 2,2-dimethyl-6-methylsulfonyl-4-pyridin-2-yl-3H-1,4-benzoxazine
2,2-dimethyl-6-methylsulfonyl-4-pyridin-2-yl-3H-1,4-benzoxazine (PubChem CID 19934570) has the molecular formula C16H18N2O3S
and a molecular weight of 318.40 g/mol. Its IUPAC name is 2,2-dimethyl-6-methylsulfonyl-4-pyridin-2-yl-3H-1,4-benzoxazine.
Molecular Properties
| Compound Name | 2,2-dimethyl-6-methylsulfonyl-4-pyridin-2-yl-3H-1,4-benzoxazine |
| PubChem CID | 19934570 |
| Molecular Formula | C16H18N2O3S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 2,2-dimethyl-6-methylsulfonyl-4-pyridin-2-yl-3H-1,4-benzoxazine |
| SMILES | CC1(C)CN(c2ccccn2)c2cc(S(C)(=O)=O)ccc2O1 |
| InChI | InChI=1S/C16H18N2O3S/c1-16(2)11-18(15-6-4-5-9-17-15)13-10-12(22(3,19)20)7-8-14(13)21-16/h4-10H,11H2,1-3H3 |
| InChIKey | KKGBODQBIOIMAI-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,2-dimethyl-6-methylsulfonyl-4-pyridin-2-yl-3H-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-6-methylsulfonyl-4-pyridin-2-yl-3H-1,4-benzoxazine?
The IUPAC name of 2,2-dimethyl-6-methylsulfonyl-4-pyridin-2-yl-3H-1,4-benzoxazine (CID 19934570) is 2,2-dimethyl-6-methylsulfonyl-4-pyridin-2-yl-3H-1,4-benzoxazine.
What is the SMILES notation for 2,2-dimethyl-6-methylsulfonyl-4-pyridin-2-yl-3H-1,4-benzoxazine?
The canonical SMILES for 2,2-dimethyl-6-methylsulfonyl-4-pyridin-2-yl-3H-1,4-benzoxazine is CC1(C)CN(c2ccccn2)c2cc(S(C)(=O)=O)ccc2O1.
What is the InChIKey of 2,2-dimethyl-6-methylsulfonyl-4-pyridin-2-yl-3H-1,4-benzoxazine?
The InChIKey is KKGBODQBIOIMAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O3S/c1-16(2)11-18(15-6-4-5-9-17-15)13-10-12(22(3,19)20)7-8-14(13)21-16/h4-10H,11H2,1-3H3.
What are the key properties of 2,2-dimethyl-6-methylsulfonyl-4-pyridin-2-yl-3H-1,4-benzoxazine?
2,2-dimethyl-6-methylsulfonyl-4-pyridin-2-yl-3H-1,4-benzoxazine has a molecular weight of 318.40 g/mol, XLogP of 2.79, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-6-methylsulfonyl-4-pyridin-2-yl-3H-1,4-benzoxazine is sourced from PubChem (CID 19934570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).