C18H19N — CID 19934858
2-methyl-6,6a,7,8,8a,12a-hexahydrobenzo[a]phenanthridine (PubChem CID 19934858) has the molecular formula C18H19N and a molecular weight of 249.36 g/mol. Its IUPAC name is 2-methyl-6,6a,7,8,8a,12a-hexahydrobenzo[a]phenanthridine.
| Compound Name | 2-methyl-6,6a,7,8,8a,12a-hexahydrobenzo[a]phenanthridine |
|---|---|
| PubChem CID | 19934858 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 2-methyl-6,6a,7,8,8a,12a-hexahydrobenzo[a]phenanthridine |
| SMILES | Cc1ccc2c(c1)=C1C(CCC3C=CC=CC13)NC=2 |
| InChI | InChI=1S/C18H19N/c1-12-6-7-14-11-19-17-9-8-13-4-2-3-5-15(13)18(17)16(14)10-12/h2-7,10-11,13,15,17,19H,8-9H2,1H3 |
| InChIKey | VWCWITNRTNQOKL-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |