About 6-[(3,5-ditert-butylphenyl)carbamoyl]pyridine-3-carboxylic acid
6-[(3,5-ditert-butylphenyl)carbamoyl]pyridine-3-carboxylic acid (PubChem CID 19934890) has the molecular formula C21H26N2O3
and a molecular weight of 354.45 g/mol. Its IUPAC name is 6-[(3,5-ditert-butylphenyl)carbamoyl]pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 6-[(3,5-ditert-butylphenyl)carbamoyl]pyridine-3-carboxylic acid |
| PubChem CID | 19934890 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 6-[(3,5-ditert-butylphenyl)carbamoyl]pyridine-3-carboxylic acid |
| SMILES | CC(C)(C)c1cc(NC(=O)c2ccc(C(=O)O)cn2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C21H26N2O3/c1-20(2,3)14-9-15(21(4,5)6)11-16(10-14)23-18(24)17-8-7-13(12-22-17)19(25)26/h7-12H,1-6H3,(H,23,24)(H,25,26) |
| InChIKey | LZNPLSCBMSDHIC-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[(3,5-ditert-butylphenyl)carbamoyl]pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(3,5-ditert-butylphenyl)carbamoyl]pyridine-3-carboxylic acid?
The IUPAC name of 6-[(3,5-ditert-butylphenyl)carbamoyl]pyridine-3-carboxylic acid (CID 19934890) is 6-[(3,5-ditert-butylphenyl)carbamoyl]pyridine-3-carboxylic acid.
What is the SMILES notation for 6-[(3,5-ditert-butylphenyl)carbamoyl]pyridine-3-carboxylic acid?
The canonical SMILES for 6-[(3,5-ditert-butylphenyl)carbamoyl]pyridine-3-carboxylic acid is CC(C)(C)c1cc(NC(=O)c2ccc(C(=O)O)cn2)cc(C(C)(C)C)c1.
What is the InChIKey of 6-[(3,5-ditert-butylphenyl)carbamoyl]pyridine-3-carboxylic acid?
The InChIKey is LZNPLSCBMSDHIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2O3/c1-20(2,3)14-9-15(21(4,5)6)11-16(10-14)23-18(24)17-8-7-13(12-22-17)19(25)26/h7-12H,1-6H3,(H,23,24)(H,25,26).
What are the key properties of 6-[(3,5-ditert-butylphenyl)carbamoyl]pyridine-3-carboxylic acid?
6-[(3,5-ditert-butylphenyl)carbamoyl]pyridine-3-carboxylic acid has a molecular weight of 354.45 g/mol, XLogP of 4.63, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(3,5-ditert-butylphenyl)carbamoyl]pyridine-3-carboxylic acid is sourced from PubChem (CID 19934890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).