C28H29Cl2N3O3 — CID 19935020
N-[[4-[(4-amino-2,3-dimethyl-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]-3-chloro-2,5-dimethylphenyl]carbamoyl]-2-chlorobenzamide (PubChem CID 19935020) has the molecular formula C28H29Cl2N3O3 and a molecular weight of 526.46 g/mol. Its IUPAC name is N-[[4-[(4-amino-2,3-dimethyl-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]-3-chloro-2,5-dimethylphenyl]carbamoyl]-2-chlorobenzamide.
| Compound Name | N-[[4-[(4-amino-2,3-dimethyl-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]-3-chloro-2,5-dimethylphenyl]carbamoyl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 19935020 |
| Molecular Formula | C28H29Cl2N3O3 |
| Molecular Weight | 526.46 g/mol |
| Exact Mass | 525.16 |
| IUPAC Name | N-[[4-[(4-amino-2,3-dimethyl-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]-3-chloro-2,5-dimethylphenyl]carbamoyl]-2-chlorobenzamide |
| SMILES | Cc1cc(NC(=O)NC(=O)c2ccccc2Cl)c(C)c(Cl)c1Oc1c(C)c(C)c(N)c2c1CCCC2 |
| InChI | InChI=1S/C28H29Cl2N3O3/c1-14-13-22(32-28(35)33-27(34)20-11-7-8-12-21(20)29)17(4)23(30)25(14)36-26-16(3)15(2)24(31)18-9-5-6-10-19(18)26/h7-8,11-13H,5-6,9-10,31H2,1-4H3,(H2,32,33,34,35) |
| InChIKey | BCKLTALIJLKDIZ-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.46 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|