About 1,4-diamino-10,10a-dihydro-1H-acridin-2-one
1,4-diamino-10,10a-dihydro-1H-acridin-2-one (PubChem CID 19935233) has the molecular formula C13H13N3O
and a molecular weight of 227.27 g/mol. Its IUPAC name is 1,4-diamino-10,10a-dihydro-1H-acridin-2-one.
Molecular Properties
| Compound Name | 1,4-diamino-10,10a-dihydro-1H-acridin-2-one |
| PubChem CID | 19935233 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 1,4-diamino-10,10a-dihydro-1H-acridin-2-one |
| SMILES | NC1=CC(=O)C(N)C2=C1NC1C=CC=CC1=C2 |
| InChI | InChI=1S/C13H13N3O/c14-9-6-11(17)12(15)8-5-7-3-1-2-4-10(7)16-13(8)9/h1-6,10,12,16H,14-15H2 |
| InChIKey | VCSBUKBQYJZZPB-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,4-diamino-10,10a-dihydro-1H-acridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diamino-10,10a-dihydro-1H-acridin-2-one?
The IUPAC name of 1,4-diamino-10,10a-dihydro-1H-acridin-2-one (CID 19935233) is 1,4-diamino-10,10a-dihydro-1H-acridin-2-one.
What is the SMILES notation for 1,4-diamino-10,10a-dihydro-1H-acridin-2-one?
The canonical SMILES for 1,4-diamino-10,10a-dihydro-1H-acridin-2-one is NC1=CC(=O)C(N)C2=C1NC1C=CC=CC1=C2.
What is the InChIKey of 1,4-diamino-10,10a-dihydro-1H-acridin-2-one?
The InChIKey is VCSBUKBQYJZZPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O/c14-9-6-11(17)12(15)8-5-7-3-1-2-4-10(7)16-13(8)9/h1-6,10,12,16H,14-15H2.
What are the key properties of 1,4-diamino-10,10a-dihydro-1H-acridin-2-one?
1,4-diamino-10,10a-dihydro-1H-acridin-2-one has a molecular weight of 227.27 g/mol, XLogP of 0.02, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diamino-10,10a-dihydro-1H-acridin-2-one is sourced from PubChem (CID 19935233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).