About 1H-pyrrole-2,4-diamine
1H-pyrrole-2,4-diamine (PubChem CID 19935251) has the molecular formula C4H7N3
and a molecular weight of 97.12 g/mol. Its IUPAC name is 1H-pyrrole-2,4-diamine.
Molecular Properties
| Compound Name | 1H-pyrrole-2,4-diamine |
| PubChem CID | 19935251 |
| Molecular Formula | C4H7N3 |
| Molecular Weight | 97.12 g/mol |
| Exact Mass | 97.06 |
| IUPAC Name | 1H-pyrrole-2,4-diamine |
| SMILES | Nc1c[nH]c(N)c1 |
| InChI | InChI=1S/C4H7N3/c5-3-1-4(6)7-2-3/h1-2,7H,5-6H2 |
| InChIKey | RCONKSIPFAYSJB-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 67.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.12 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-pyrrole-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrrole-2,4-diamine?
The IUPAC name of 1H-pyrrole-2,4-diamine (CID 19935251) is 1H-pyrrole-2,4-diamine.
What is the SMILES notation for 1H-pyrrole-2,4-diamine?
The canonical SMILES for 1H-pyrrole-2,4-diamine is Nc1c[nH]c(N)c1.
What is the InChIKey of 1H-pyrrole-2,4-diamine?
The InChIKey is RCONKSIPFAYSJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3/c5-3-1-4(6)7-2-3/h1-2,7H,5-6H2.
What are the key properties of 1H-pyrrole-2,4-diamine?
1H-pyrrole-2,4-diamine has a molecular weight of 97.12 g/mol, XLogP of 0.18, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrrole-2,4-diamine is sourced from PubChem (CID 19935251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).