About 5,5-dimethyl-3,4-dihydro-2H-1-benzothiepine
5,5-dimethyl-3,4-dihydro-2H-1-benzothiepine (PubChem CID 19935502) has the molecular formula C12H16S
and a molecular weight of 192.33 g/mol. Its IUPAC name is 5,5-dimethyl-3,4-dihydro-2H-1-benzothiepine.
Molecular Properties
| Compound Name | 5,5-dimethyl-3,4-dihydro-2H-1-benzothiepine |
| PubChem CID | 19935502 |
| Molecular Formula | C12H16S |
| Molecular Weight | 192.33 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 5,5-dimethyl-3,4-dihydro-2H-1-benzothiepine |
| SMILES | CC1(C)CCCSc2ccccc21 |
| InChI | InChI=1S/C12H16S/c1-12(2)8-5-9-13-11-7-4-3-6-10(11)12/h3-4,6-7H,5,8-9H2,1-2H3 |
| InChIKey | KZJCJQDMJPYMQL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.33 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5,5-dimethyl-3,4-dihydro-2H-1-benzothiepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-3,4-dihydro-2H-1-benzothiepine?
The IUPAC name of 5,5-dimethyl-3,4-dihydro-2H-1-benzothiepine (CID 19935502) is 5,5-dimethyl-3,4-dihydro-2H-1-benzothiepine.
What is the SMILES notation for 5,5-dimethyl-3,4-dihydro-2H-1-benzothiepine?
The canonical SMILES for 5,5-dimethyl-3,4-dihydro-2H-1-benzothiepine is CC1(C)CCCSc2ccccc21.
What is the InChIKey of 5,5-dimethyl-3,4-dihydro-2H-1-benzothiepine?
The InChIKey is KZJCJQDMJPYMQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16S/c1-12(2)8-5-9-13-11-7-4-3-6-10(11)12/h3-4,6-7H,5,8-9H2,1-2H3.
What are the key properties of 5,5-dimethyl-3,4-dihydro-2H-1-benzothiepine?
5,5-dimethyl-3,4-dihydro-2H-1-benzothiepine has a molecular weight of 192.33 g/mol, XLogP of 3.85, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-3,4-dihydro-2H-1-benzothiepine is sourced from PubChem (CID 19935502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).