C11H14S — CID 19935526
5-methyl-2,3,4,5-tetrahydro-1-benzothiepine (PubChem CID 19935526) has the molecular formula C11H14S and a molecular weight of 178.30 g/mol. Its IUPAC name is 5-methyl-2,3,4,5-tetrahydro-1-benzothiepine.
| Compound Name | 5-methyl-2,3,4,5-tetrahydro-1-benzothiepine |
|---|---|
| PubChem CID | 19935526 |
| Molecular Formula | C11H14S |
| Molecular Weight | 178.30 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 5-methyl-2,3,4,5-tetrahydro-1-benzothiepine |
| SMILES | CC1CCCSc2ccccc21 |
| InChI | InChI=1S/C11H14S/c1-9-5-4-8-12-11-7-3-2-6-10(9)11/h2-3,6-7,9H,4-5,8H2,1H3 |
| InChIKey | GDJGCKFMVKHAEP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.30 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |