C23H24F3N3O2S — CID 19935856
2-[(Z)-1-[4-[3-[3-methoxy-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]phenyl]sulfanylphenyl]ethylideneamino]oxyacetonitrile (PubChem CID 19935856) has the molecular formula C23H24F3N3O2S and a molecular weight of 463.53 g/mol. Its IUPAC name is 2-[(Z)-1-[4-[3-[3-methoxy-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]phenyl]sulfanylphenyl]ethylideneamino]oxyacetonitrile.
| Compound Name | 2-[(Z)-1-[4-[3-[3-methoxy-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]phenyl]sulfanylphenyl]ethylideneamino]oxyacetonitrile |
|---|---|
| PubChem CID | 19935856 |
| Molecular Formula | C23H24F3N3O2S |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | 2-[(Z)-1-[4-[3-[3-methoxy-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]phenyl]sulfanylphenyl]ethylideneamino]oxyacetonitrile |
| SMILES | COC1(c2cccc(Sc3ccc(/C(C)=N\OCC#N)cc3)c2)CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C23H24F3N3O2S/c1-17(28-31-13-11-27)18-6-8-20(9-7-18)32-21-5-3-4-19(14-21)22(30-2)10-12-29(15-22)16-23(24,25)26/h3-9,14H,10,12-13,15-16H2,1-2H3/b28-17- |
| InChIKey | JMCKGDJXSPBHOU-QRQIAZFYSA-N |
| XLogP | 5.21 |
| TPSA | 57.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|