About N,N-dibutyl-1,3,5-triazin-2-amine
N,N-dibutyl-1,3,5-triazin-2-amine (PubChem CID 19936182) has the molecular formula C11H20N4
and a molecular weight of 208.31 g/mol. Its IUPAC name is N,N-dibutyl-1,3,5-triazin-2-amine.
Molecular Properties
| Compound Name | N,N-dibutyl-1,3,5-triazin-2-amine |
| PubChem CID | 19936182 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | N,N-dibutyl-1,3,5-triazin-2-amine |
| SMILES | CCCCN(CCCC)c1ncncn1 |
| InChI | InChI=1S/C11H20N4/c1-3-5-7-15(8-6-4-2)11-13-9-12-10-14-11/h9-10H,3-8H2,1-2H3 |
| InChIKey | DOXSTSAQLHLMDK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-dibutyl-1,3,5-triazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dibutyl-1,3,5-triazin-2-amine?
The IUPAC name of N,N-dibutyl-1,3,5-triazin-2-amine (CID 19936182) is N,N-dibutyl-1,3,5-triazin-2-amine.
What is the SMILES notation for N,N-dibutyl-1,3,5-triazin-2-amine?
The canonical SMILES for N,N-dibutyl-1,3,5-triazin-2-amine is CCCCN(CCCC)c1ncncn1.
What is the InChIKey of N,N-dibutyl-1,3,5-triazin-2-amine?
The InChIKey is DOXSTSAQLHLMDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4/c1-3-5-7-15(8-6-4-2)11-13-9-12-10-14-11/h9-10H,3-8H2,1-2H3.
What are the key properties of N,N-dibutyl-1,3,5-triazin-2-amine?
N,N-dibutyl-1,3,5-triazin-2-amine has a molecular weight of 208.31 g/mol, XLogP of 2.28, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dibutyl-1,3,5-triazin-2-amine is sourced from PubChem (CID 19936182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).