C18H32N4O9 — CID 19936259
2-[4,7,10-tris(carboxymethyl)-6-(2-hydroxyethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 19936259) has the molecular formula C18H32N4O9 and a molecular weight of 448.47 g/mol. Its IUPAC name is 2-[4,7,10-tris(carboxymethyl)-6-(2-hydroxyethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7,10-tris(carboxymethyl)-6-(2-hydroxyethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 19936259 |
| Molecular Formula | C18H32N4O9 |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 2-[4,7,10-tris(carboxymethyl)-6-(2-hydroxyethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)O)C(CCO)CN(CC(=O)O)CC1 |
| InChI | InChI=1S/C18H32N4O9/c23-8-1-14-9-21(12-17(28)29)5-4-19(10-15(24)25)2-3-20(11-16(26)27)6-7-22(14)13-18(30)31/h14,23H,1-13H2,(H,24,25)(H,26,27)(H,28,29)(H,30,31) |
| InChIKey | NVOHPFBJVSDPAV-UHFFFAOYSA-N |
| XLogP | -2.70 |
| TPSA | 182.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |