C24H26F3N3O2 — CID 19936436
3-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-1H-indole-5-carboxylic acid (PubChem CID 19936436) has the molecular formula C24H26F3N3O2 and a molecular weight of 445.49 g/mol. Its IUPAC name is 3-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-1H-indole-5-carboxylic acid.
| Compound Name | 3-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-1H-indole-5-carboxylic acid |
|---|---|
| PubChem CID | 19936436 |
| Molecular Formula | C24H26F3N3O2 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 3-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-1H-indole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2[nH]cc(CCCCN3CCN(c4cccc(C(F)(F)F)c4)CC3)c2c1 |
| InChI | InChI=1S/C24H26F3N3O2/c25-24(26,27)19-5-3-6-20(15-19)30-12-10-29(11-13-30)9-2-1-4-18-16-28-22-8-7-17(23(31)32)14-21(18)22/h3,5-8,14-16,28H,1-2,4,9-13H2,(H,31,32) |
| InChIKey | YUXWXUZMMNZWEC-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 59.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|