About 2-(2-methylcyclopenta-1,3-dien-1-yl)propan-2-ol;zirconium
2-(2-methylcyclopenta-1,3-dien-1-yl)propan-2-ol;zirconium (PubChem CID 19936950) has the molecular formula C9H14OZr
and a molecular weight of 229.43 g/mol. Its IUPAC name is 2-(2-methylcyclopenta-1,3-dien-1-yl)propan-2-ol;zirconium.
Molecular Properties
| Compound Name | 2-(2-methylcyclopenta-1,3-dien-1-yl)propan-2-ol;zirconium |
| PubChem CID | 19936950 |
| Molecular Formula | C9H14OZr |
| Molecular Weight | 229.43 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | 2-(2-methylcyclopenta-1,3-dien-1-yl)propan-2-ol;zirconium |
| SMILES | CC1=C(C(C)(C)O)CC=C1.[Zr] |
| InChI | InChI=1S/C9H14O.Zr/c1-7-5-4-6-8(7)9(2,3)10;/h4-5,10H,6H2,1-3H3; |
| InChIKey | YVXCEHKVJBVARK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.43 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2-methylcyclopenta-1,3-dien-1-yl)propan-2-ol;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylcyclopenta-1,3-dien-1-yl)propan-2-ol;zirconium?
The IUPAC name of 2-(2-methylcyclopenta-1,3-dien-1-yl)propan-2-ol;zirconium (CID 19936950) is 2-(2-methylcyclopenta-1,3-dien-1-yl)propan-2-ol;zirconium.
What is the SMILES notation for 2-(2-methylcyclopenta-1,3-dien-1-yl)propan-2-ol;zirconium?
The canonical SMILES for 2-(2-methylcyclopenta-1,3-dien-1-yl)propan-2-ol;zirconium is CC1=C(C(C)(C)O)CC=C1.[Zr].
What is the InChIKey of 2-(2-methylcyclopenta-1,3-dien-1-yl)propan-2-ol;zirconium?
The InChIKey is YVXCEHKVJBVARK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O.Zr/c1-7-5-4-6-8(7)9(2,3)10;/h4-5,10H,6H2,1-3H3;.
What are the key properties of 2-(2-methylcyclopenta-1,3-dien-1-yl)propan-2-ol;zirconium?
2-(2-methylcyclopenta-1,3-dien-1-yl)propan-2-ol;zirconium has a molecular weight of 229.43 g/mol, XLogP of 2.03, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylcyclopenta-1,3-dien-1-yl)propan-2-ol;zirconium is sourced from PubChem (CID 19936950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).