About 5-fluoro-1,3-benzoxazole
5-fluoro-1,3-benzoxazole (PubChem CID 19937167) has the molecular formula C7H4FNO
and a molecular weight of 137.11 g/mol. Its IUPAC name is 5-fluoro-1,3-benzoxazole.
Molecular Properties
| Compound Name | 5-fluoro-1,3-benzoxazole |
| PubChem CID | 19937167 |
| Molecular Formula | C7H4FNO |
| Molecular Weight | 137.11 g/mol |
| Exact Mass | 137.03 |
| IUPAC Name | 5-fluoro-1,3-benzoxazole |
| SMILES | Fc1ccc2ocnc2c1 |
| InChI | InChI=1S/C7H4FNO/c8-5-1-2-7-6(3-5)9-4-10-7/h1-4H |
| InChIKey | ZRMPAEOUOPNNPZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.11 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1,3-benzoxazole?
The IUPAC name of 5-fluoro-1,3-benzoxazole (CID 19937167) is 5-fluoro-1,3-benzoxazole.
What is the SMILES notation for 5-fluoro-1,3-benzoxazole?
The canonical SMILES for 5-fluoro-1,3-benzoxazole is Fc1ccc2ocnc2c1.
What is the InChIKey of 5-fluoro-1,3-benzoxazole?
The InChIKey is ZRMPAEOUOPNNPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4FNO/c8-5-1-2-7-6(3-5)9-4-10-7/h1-4H.
What are the key properties of 5-fluoro-1,3-benzoxazole?
5-fluoro-1,3-benzoxazole has a molecular weight of 137.11 g/mol, XLogP of 1.97, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1,3-benzoxazole is sourced from PubChem (CID 19937167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).